I got a G sample of this in the mail and wanted to ask what people think about this and if there are already faster labowls with experiences?
First reports sound a bit too good, something about similar to 3FPM and Amphetamine and derived from 4F-MPH although personally I can't compare both on the same level, 3FPM is very different from all Ephe/Amph/Cath stuff and feels really sedating for me, and after seeing how many possible metabolites this stuff can form, I really don't wonder about cardiovascular side effects that had been observed as well as why the non-halogenated one was used to stop hunger as there seem to be many metabolites with those "body building booster" thingy structures or how they are called, with those octopamine synephrine whatever pseudo-stims that mainly raise blood pressure etc.
Somehow I find those structures a bit scary with those extra nitrogens and older drugs with such configurations like Pemoline were as problematic as my gut feeling tells me, although others like Cyclazodone and Methyl-Cyclazodone seem to be less harmful but I wonder how they can state that without many studies and years of experience, usually it takes 15 years until a drug is really "researched" and further classified according to the severity of side effects and also the worldview of those deciding about it (just look at the sildenfinil situation where it gets more and more OTC in many countries as there simply haven't been any problematic effects been observed in healthy people so there is no reason to forbid adult people to put it into their body, but in Germany the buerorats instantly think "oh no that cannot be allowed people can't use it responsibly people are too dumb" (even though everyone can legally get a online prescription without any further questions etc., and everyone can put holes into his stomach legally with too much ASS...)
5-((3-fluorophenyl)(piperidin-2-yl)methyl)-3-methyl-1,2,4-oxadiazol
FC=1C=C(C=CC1)C(C1=NC(=NO1)C)C1NCCCC1
SwissTargetPrediction
First reports sound a bit too good, something about similar to 3FPM and Amphetamine and derived from 4F-MPH although personally I can't compare both on the same level, 3FPM is very different from all Ephe/Amph/Cath stuff and feels really sedating for me, and after seeing how many possible metabolites this stuff can form, I really don't wonder about cardiovascular side effects that had been observed as well as why the non-halogenated one was used to stop hunger as there seem to be many metabolites with those "body building booster" thingy structures or how they are called, with those octopamine synephrine whatever pseudo-stims that mainly raise blood pressure etc.
Somehow I find those structures a bit scary with those extra nitrogens and older drugs with such configurations like Pemoline were as problematic as my gut feeling tells me, although others like Cyclazodone and Methyl-Cyclazodone seem to be less harmful but I wonder how they can state that without many studies and years of experience, usually it takes 15 years until a drug is really "researched" and further classified according to the severity of side effects and also the worldview of those deciding about it (just look at the sildenfinil situation where it gets more and more OTC in many countries as there simply haven't been any problematic effects been observed in healthy people so there is no reason to forbid adult people to put it into their body, but in Germany the buerorats instantly think "oh no that cannot be allowed people can't use it responsibly people are too dumb" (even though everyone can legally get a online prescription without any further questions etc., and everyone can put holes into his stomach legally with too much ASS...)
5-((3-fluorophenyl)(piperidin-2-yl)methyl)-3-methyl-1,2,4-oxadiazol
FC=1C=C(C=CC1)C(C1=NC(=NO1)C)C1NCCCC1
SwissTargetPrediction
Last edited:
